C18H34O4 — CID 11347569
(3R)-2-(1-hydroxytridecyl)cyclopent-4-ene-1,2,3-triol (PubChem CID 11347569) has the molecular formula C18H34O4 and a molecular weight of 314.47 g/mol. Its IUPAC name is (3R)-2-(1-hydroxytridecyl)cyclopent-4-ene-1,2,3-triol.
| Compound Name | (3R)-2-(1-hydroxytridecyl)cyclopent-4-ene-1,2,3-triol |
|---|---|
| PubChem CID | 11347569 |
| Molecular Formula | C18H34O4 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.25 |
| IUPAC Name | (3R)-2-(1-hydroxytridecyl)cyclopent-4-ene-1,2,3-triol |
| SMILES | CCCCCCCCCCCCC(O)C1(O)C(O)C=C[C@H]1O |
| InChI | InChI=1S/C18H34O4/c1-2-3-4-5-6-7-8-9-10-11-12-15(19)18(22)16(20)13-14-17(18)21/h13-17,19-22H,2-12H2,1H3/t15?,16-,17?,18?/m1/s1 |
| InChIKey | RGWQUBIEDNJLQF-JYJOREJMSA-N |
| XLogP | 2.68 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|