C9H18O2 — CID 10975771
(1R)-1-[(2S)-3,3-dimethyloxiran-2-yl]pentan-1-ol (PubChem CID 10975771) has the molecular formula C9H18O2 and a molecular weight of 158.24 g/mol. Its IUPAC name is (1R)-1-[(2S)-3,3-dimethyloxiran-2-yl]pentan-1-ol.
| Compound Name | (1R)-1-[(2S)-3,3-dimethyloxiran-2-yl]pentan-1-ol |
|---|---|
| PubChem CID | 10975771 |
| Molecular Formula | C9H18O2 |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.13 |
| IUPAC Name | (1R)-1-[(2S)-3,3-dimethyloxiran-2-yl]pentan-1-ol |
| SMILES | CCCC[C@@H](O)[C@@H]1OC1(C)C |
| InChI | InChI=1S/C9H18O2/c1-4-5-6-7(10)8-9(2,3)11-8/h7-8,10H,4-6H2,1-3H3/t7-,8+/m1/s1 |
| InChIKey | CLTMVQLKRINELB-SFYZADRCSA-N |
| XLogP | 1.71 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|