C13H24O3 — CID 10353745
(1S)-1-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]pentan-1-ol (PubChem CID 10353745) has the molecular formula C13H24O3 and a molecular weight of 228.33 g/mol. Its IUPAC name is (1S)-1-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]pentan-1-ol.
| Compound Name | (1S)-1-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]pentan-1-ol |
|---|---|
| PubChem CID | 10353745 |
| Molecular Formula | C13H24O3 |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | (1S)-1-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]pentan-1-ol |
| SMILES | CCCC[C@H](O)[C@H]1COC2(CCCCC2)O1 |
| InChI | InChI=1S/C13H24O3/c1-2-3-7-11(14)12-10-15-13(16-12)8-5-4-6-9-13/h11-12,14H,2-10H2,1H3/t11-,12+/m0/s1 |
| InChIKey | MFFKJHMTZNCXEB-NWDGAFQWSA-N |
| XLogP | 2.61 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |