C21H30O4 — CID 139247490
1-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]hexyl benzoate (PubChem CID 139247490) has the molecular formula C21H30O4 and a molecular weight of 346.47 g/mol. Its IUPAC name is 1-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]hexyl benzoate.
| Compound Name | 1-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]hexyl benzoate |
|---|---|
| PubChem CID | 139247490 |
| Molecular Formula | C21H30O4 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | 1-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]hexyl benzoate |
| SMILES | CCCCCC(OC(=O)c1ccccc1)[C@H]1COC2(CCCCC2)O1 |
| InChI | InChI=1S/C21H30O4/c1-2-3-6-13-18(24-20(22)17-11-7-4-8-12-17)19-16-23-21(25-19)14-9-5-10-15-21/h4,7-8,11-12,18-19H,2-3,5-6,9-10,13-16H2,1H3/t18?,19-/m1/s1 |
| InChIKey | VNXXYAVHHSRGCX-MUMRKEEXSA-N |
| XLogP | 4.87 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|