About N,N-dihydroxydecan-5-amine
N,N-dihydroxydecan-5-amine (PubChem CID 88629686) has the molecular formula C10H23NO2
and a molecular weight of 189.30 g/mol. Its IUPAC name is N,N-dihydroxydecan-5-amine.
Molecular Properties
| Compound Name | N,N-dihydroxydecan-5-amine |
| PubChem CID | 88629686 |
| Molecular Formula | C10H23NO2 |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.17 |
| IUPAC Name | N,N-dihydroxydecan-5-amine |
| SMILES | CCCCCC(CCCC)N(O)O |
| InChI | InChI=1S/C10H23NO2/c1-3-5-7-9-10(11(12)13)8-6-4-2/h10,12-13H,3-9H2,1-2H3 |
| InChIKey | ZZBBCRLEGZEFFX-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N,N-dihydroxydecan-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dihydroxydecan-5-amine?
The IUPAC name of N,N-dihydroxydecan-5-amine (CID 88629686) is N,N-dihydroxydecan-5-amine.
What is the SMILES notation for N,N-dihydroxydecan-5-amine?
The canonical SMILES for N,N-dihydroxydecan-5-amine is CCCCCC(CCCC)N(O)O.
What is the InChIKey of N,N-dihydroxydecan-5-amine?
The InChIKey is ZZBBCRLEGZEFFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H23NO2/c1-3-5-7-9-10(11(12)13)8-6-4-2/h10,12-13H,3-9H2,1-2H3.
What are the key properties of N,N-dihydroxydecan-5-amine?
N,N-dihydroxydecan-5-amine has a molecular weight of 189.30 g/mol, XLogP of 3.21, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dihydroxydecan-5-amine is sourced from PubChem (CID 88629686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).