C9H21NO2 — CID 139703467
N,N-dihydroxynonan-4-amine (PubChem CID 139703467) has the molecular formula C9H21NO2 and a molecular weight of 175.27 g/mol. Its IUPAC name is N,N-dihydroxynonan-4-amine.
| Compound Name | N,N-dihydroxynonan-4-amine |
|---|---|
| PubChem CID | 139703467 |
| Molecular Formula | C9H21NO2 |
| Molecular Weight | 175.27 g/mol |
| Exact Mass | 175.16 |
| IUPAC Name | N,N-dihydroxynonan-4-amine |
| SMILES | CCCCCC(CCC)N(O)O |
| InChI | InChI=1S/C9H21NO2/c1-3-5-6-8-9(7-4-2)10(11)12/h9,11-12H,3-8H2,1-2H3 |
| InChIKey | CRPPXJHAMPMCCT-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.27 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|