C9H23N3 — CID 88511755
N,N-diaminononan-5-amine (PubChem CID 88511755) has the molecular formula C9H23N3 and a molecular weight of 173.30 g/mol. Its IUPAC name is N,N-diaminononan-5-amine.
| Compound Name | N,N-diaminononan-5-amine |
|---|---|
| PubChem CID | 88511755 |
| Molecular Formula | C9H23N3 |
| Molecular Weight | 173.30 g/mol |
| Exact Mass | 173.19 |
| IUPAC Name | N,N-diaminononan-5-amine |
| SMILES | CCCCC(CCCC)N(N)N |
| InChI | InChI=1S/C9H23N3/c1-3-5-7-9(12(10)11)8-6-4-2/h9H,3-8,10-11H2,1-2H3 |
| InChIKey | UCGCLUHWCJOHRF-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.30 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|