About [(1R)-1-[(2S)-3,3-dimethyloxiran-2-yl]heptyl] acetate
[(1R)-1-[(2S)-3,3-dimethyloxiran-2-yl]heptyl] acetate (PubChem CID 10443772) has the molecular formula C13H24O3
and a molecular weight of 228.33 g/mol. Its IUPAC name is [(1R)-1-[(2S)-3,3-dimethyloxiran-2-yl]heptyl] acetate.
Molecular Properties
| Compound Name | [(1R)-1-[(2S)-3,3-dimethyloxiran-2-yl]heptyl] acetate |
| PubChem CID | 10443772 |
| Molecular Formula | C13H24O3 |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | [(1R)-1-[(2S)-3,3-dimethyloxiran-2-yl]heptyl] acetate |
| SMILES | CCCCCC[C@@H](OC(C)=O)[C@@H]1OC1(C)C |
| InChI | InChI=1S/C13H24O3/c1-5-6-7-8-9-11(15-10(2)14)12-13(3,4)16-12/h11-12H,5-9H2,1-4H3/t11-,12+/m1/s1 |
| InChIKey | MVCSOGYPMNUBCA-NEPJUHHUSA-N |
| XLogP | 3.07 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze [(1R)-1-[(2S)-3,3-dimethyloxiran-2-yl]heptyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R)-1-[(2S)-3,3-dimethyloxiran-2-yl]heptyl] acetate?
The IUPAC name of [(1R)-1-[(2S)-3,3-dimethyloxiran-2-yl]heptyl] acetate (CID 10443772) is [(1R)-1-[(2S)-3,3-dimethyloxiran-2-yl]heptyl] acetate.
What is the SMILES notation for [(1R)-1-[(2S)-3,3-dimethyloxiran-2-yl]heptyl] acetate?
The canonical SMILES for [(1R)-1-[(2S)-3,3-dimethyloxiran-2-yl]heptyl] acetate is CCCCCC[C@@H](OC(C)=O)[C@@H]1OC1(C)C.
What is the InChIKey of [(1R)-1-[(2S)-3,3-dimethyloxiran-2-yl]heptyl] acetate?
The InChIKey is MVCSOGYPMNUBCA-NEPJUHHUSA-N. The full InChI is InChI=1S/C13H24O3/c1-5-6-7-8-9-11(15-10(2)14)12-13(3,4)16-12/h11-12H,5-9H2,1-4H3/t11-,12+/m1/s1.
What are the key properties of [(1R)-1-[(2S)-3,3-dimethyloxiran-2-yl]heptyl] acetate?
[(1R)-1-[(2S)-3,3-dimethyloxiran-2-yl]heptyl] acetate has a molecular weight of 228.33 g/mol, XLogP of 3.07, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R)-1-[(2S)-3,3-dimethyloxiran-2-yl]heptyl] acetate is sourced from PubChem (CID 10443772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).