C10H18O4 — CID 10058668
1-(1,3-dioxolan-2-yl)pentyl acetate (PubChem CID 10058668) has the molecular formula C10H18O4 and a molecular weight of 202.25 g/mol. Its IUPAC name is 1-(1,3-dioxolan-2-yl)pentyl acetate.
| Compound Name | 1-(1,3-dioxolan-2-yl)pentyl acetate |
|---|---|
| PubChem CID | 10058668 |
| Molecular Formula | C10H18O4 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | 1-(1,3-dioxolan-2-yl)pentyl acetate |
| SMILES | CCCCC(OC(C)=O)C1OCCO1 |
| InChI | InChI=1S/C10H18O4/c1-3-4-5-9(14-8(2)11)10-12-6-7-13-10/h9-10H,3-7H2,1-2H3 |
| InChIKey | MLXGMIXJQAPRKJ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |