C5H6O4 — CID 131848654
(5R)-5-(hydroxymethyl)oxolane-2,4-dione (PubChem CID 131848654) has the molecular formula C5H6O4 and a molecular weight of 130.10 g/mol. Its IUPAC name is (5R)-5-(hydroxymethyl)oxolane-2,4-dione.
| Compound Name | (5R)-5-(hydroxymethyl)oxolane-2,4-dione |
|---|---|
| PubChem CID | 131848654 |
| Molecular Formula | C5H6O4 |
| Molecular Weight | 130.10 g/mol |
| Exact Mass | 130.03 |
| IUPAC Name | (5R)-5-(hydroxymethyl)oxolane-2,4-dione |
| SMILES | O=C1CC(=O)[C@@H](CO)O1 |
| InChI | InChI=1S/C5H6O4/c6-2-4-3(7)1-5(8)9-4/h4,6H,1-2H2/t4-/m1/s1 |
| InChIKey | ICVAYHRUYSDPHE-SCSAIBSYSA-N |
| XLogP | -1.14 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.10 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|