About (5S)-5-methyloxolane-2,4-dione
(5S)-5-methyloxolane-2,4-dione (PubChem CID 67483929) has the molecular formula C5H6O3
and a molecular weight of 114.10 g/mol. Its IUPAC name is (5S)-5-methyloxolane-2,4-dione.
Molecular Properties
| Compound Name | (5S)-5-methyloxolane-2,4-dione |
| PubChem CID | 67483929 |
| Molecular Formula | C5H6O3 |
| Molecular Weight | 114.10 g/mol |
| Exact Mass | 114.03 |
| IUPAC Name | (5S)-5-methyloxolane-2,4-dione |
| SMILES | C[C@@H]1OC(=O)CC1=O |
| InChI | InChI=1S/C5H6O3/c1-3-4(6)2-5(7)8-3/h3H,2H2,1H3/t3-/m0/s1 |
| InChIKey | ZIQFRNVCLDSOAB-VKHMYHEASA-N |
| XLogP | -0.11 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.10 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze (5S)-5-methyloxolane-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-5-methyloxolane-2,4-dione?
The IUPAC name of (5S)-5-methyloxolane-2,4-dione (CID 67483929) is (5S)-5-methyloxolane-2,4-dione.
What is the SMILES notation for (5S)-5-methyloxolane-2,4-dione?
The canonical SMILES for (5S)-5-methyloxolane-2,4-dione is C[C@@H]1OC(=O)CC1=O.
What is the InChIKey of (5S)-5-methyloxolane-2,4-dione?
The InChIKey is ZIQFRNVCLDSOAB-VKHMYHEASA-N. The full InChI is InChI=1S/C5H6O3/c1-3-4(6)2-5(7)8-3/h3H,2H2,1H3/t3-/m0/s1.
What are the key properties of (5S)-5-methyloxolane-2,4-dione?
(5S)-5-methyloxolane-2,4-dione has a molecular weight of 114.10 g/mol, XLogP of -0.11, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-5-methyloxolane-2,4-dione is sourced from PubChem (CID 67483929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).