C5H6O3 — CID 67483929
(5S)-5-methyloxolane-2,4-dione (PubChem CID 67483929) has the molecular formula C5H6O3 and a molecular weight of 114.10 g/mol. Its IUPAC name is (5S)-5-methyloxolane-2,4-dione.
| Compound Name | (5S)-5-methyloxolane-2,4-dione |
|---|---|
| PubChem CID | 67483929 |
| Molecular Formula | C5H6O3 |
| Molecular Weight | 114.10 g/mol |
| Exact Mass | 114.03 |
| IUPAC Name | (5S)-5-methyloxolane-2,4-dione |
| SMILES | C[C@@H]1OC(=O)CC1=O |
| InChI | InChI=1S/C5H6O3/c1-3-4(6)2-5(7)8-3/h3H,2H2,1H3/t3-/m0/s1 |
| InChIKey | ZIQFRNVCLDSOAB-VKHMYHEASA-N |
| XLogP | -0.11 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 114.10 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|