C6H8O3 — CID 11804775
(6R)-6-methyloxane-2,4-dione (PubChem CID 11804775) has the molecular formula C6H8O3 and a molecular weight of 128.13 g/mol. Its IUPAC name is (6R)-6-methyloxane-2,4-dione.
| Compound Name | (6R)-6-methyloxane-2,4-dione |
|---|---|
| PubChem CID | 11804775 |
| Molecular Formula | C6H8O3 |
| Molecular Weight | 128.13 g/mol |
| Exact Mass | 128.05 |
| IUPAC Name | (6R)-6-methyloxane-2,4-dione |
| SMILES | C[C@@H]1CC(=O)CC(=O)O1 |
| InChI | InChI=1S/C6H8O3/c1-4-2-5(7)3-6(8)9-4/h4H,2-3H2,1H3/t4-/m1/s1 |
| InChIKey | UUVIHKCBKAOTEW-SCSAIBSYSA-N |
| XLogP | 0.28 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.13 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|