C12H22O3 — CID 170769466
(5S)-5,6-dimethyloxane-2,4-dione;pentane (PubChem CID 170769466) has the molecular formula C12H22O3 and a molecular weight of 214.30 g/mol. Its IUPAC name is (5S)-5,6-dimethyloxane-2,4-dione;pentane.
| Compound Name | (5S)-5,6-dimethyloxane-2,4-dione;pentane |
|---|---|
| PubChem CID | 170769466 |
| Molecular Formula | C12H22O3 |
| Molecular Weight | 214.30 g/mol |
| Exact Mass | 214.16 |
| IUPAC Name | (5S)-5,6-dimethyloxane-2,4-dione;pentane |
| SMILES | CC1OC(=O)CC(=O)[C@H]1C.CCCCC |
| InChI | InChI=1S/C7H10O3.C5H12/c1-4-5(2)10-7(9)3-6(4)8;1-3-5-4-2/h4-5H,3H2,1-2H3;3-5H2,1-2H3/t4-,5?;/m0./s1 |
| InChIKey | PNZWGKSPAROBBJ-PHHGQXFYSA-N |
| XLogP | 2.72 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.30 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|