C14H24O4 — CID 152576161
2-(5-methylnonan-5-yl)-1,3-dioxane-4,6-dione (PubChem CID 152576161) has the molecular formula C14H24O4 and a molecular weight of 256.34 g/mol. Its IUPAC name is 2-(5-methylnonan-5-yl)-1,3-dioxane-4,6-dione.
| Compound Name | 2-(5-methylnonan-5-yl)-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 152576161 |
| Molecular Formula | C14H24O4 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | 2-(5-methylnonan-5-yl)-1,3-dioxane-4,6-dione |
| SMILES | CCCCC(C)(CCCC)C1OC(=O)CC(=O)O1 |
| InChI | InChI=1S/C14H24O4/c1-4-6-8-14(3,9-7-5-2)13-17-11(15)10-12(16)18-13/h13H,4-10H2,1-3H3 |
| InChIKey | YSNBNPYORUHDPD-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|