C13H24O3 — CID 126657431
6-(3,3-dimethylhexyl)-4-hydroxyoxan-2-one (PubChem CID 126657431) has the molecular formula C13H24O3 and a molecular weight of 228.33 g/mol. Its IUPAC name is 6-(3,3-dimethylhexyl)-4-hydroxyoxan-2-one.
| Compound Name | 6-(3,3-dimethylhexyl)-4-hydroxyoxan-2-one |
|---|---|
| PubChem CID | 126657431 |
| Molecular Formula | C13H24O3 |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | 6-(3,3-dimethylhexyl)-4-hydroxyoxan-2-one |
| SMILES | CCCC(C)(C)CCC1CC(O)CC(=O)O1 |
| InChI | InChI=1S/C13H24O3/c1-4-6-13(2,3)7-5-11-8-10(14)9-12(15)16-11/h10-11,14H,4-9H2,1-3H3 |
| InChIKey | ZHMIMOZSOUVBRN-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |