C18H34O5 — CID 162920916
6-(7,10-dihydroxy-5,7-dimethylundecyl)-4-hydroxyoxan-2-one (PubChem CID 162920916) has the molecular formula C18H34O5 and a molecular weight of 330.47 g/mol. Its IUPAC name is 6-(7,10-dihydroxy-5,7-dimethylundecyl)-4-hydroxyoxan-2-one.
| Compound Name | 6-(7,10-dihydroxy-5,7-dimethylundecyl)-4-hydroxyoxan-2-one |
|---|---|
| PubChem CID | 162920916 |
| Molecular Formula | C18H34O5 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.24 |
| IUPAC Name | 6-(7,10-dihydroxy-5,7-dimethylundecyl)-4-hydroxyoxan-2-one |
| SMILES | CC(O)CCC(C)(O)CC(C)CCCCC1CC(O)CC(=O)O1 |
| InChI | InChI=1S/C18H34O5/c1-13(12-18(3,22)9-8-14(2)19)6-4-5-7-16-10-15(20)11-17(21)23-16/h13-16,19-20,22H,4-12H2,1-3H3 |
| InChIKey | VOOPCCURDRUEPN-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|