C18H32O5 — CID 177431421
(2S,3S,4Z,6S)-3,6,8-trihydroxy-2-nonyl-2,3,6,7,8,9-hexahydrooxecin-10-one (PubChem CID 177431421) has the molecular formula C18H32O5 and a molecular weight of 328.45 g/mol. Its IUPAC name is (2S,3S,4Z,6S)-3,6,8-trihydroxy-2-nonyl-2,3,6,7,8,9-hexahydrooxecin-10-one.
| Compound Name | (2S,3S,4Z,6S)-3,6,8-trihydroxy-2-nonyl-2,3,6,7,8,9-hexahydrooxecin-10-one |
|---|---|
| PubChem CID | 177431421 |
| Molecular Formula | C18H32O5 |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | (2S,3S,4Z,6S)-3,6,8-trihydroxy-2-nonyl-2,3,6,7,8,9-hexahydrooxecin-10-one |
| SMILES | CCCCCCCCC[C@@H]1OC(=O)CC(O)C[C@H](O)/C=C\[C@@H]1O |
| InChI | InChI=1S/C18H32O5/c1-2-3-4-5-6-7-8-9-17-16(21)11-10-14(19)12-15(20)13-18(22)23-17/h10-11,14-17,19-21H,2-9,12-13H2,1H3/b11-10-/t14-,15?,16+,17+/m1/s1 |
| InChIKey | HFGOXJHLMBNOHC-QNBBFBKFSA-N |
| XLogP | 2.47 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|