C18H32O5 — CID 177478080
(2R,4S,5S,8S)-4,5,8-trihydroxy-2-nonyl-2,3,4,5,8,9-hexahydrooxecin-10-one (PubChem CID 177478080) has the molecular formula C18H32O5 and a molecular weight of 328.45 g/mol. Its IUPAC name is (2R,4S,5S,8S)-4,5,8-trihydroxy-2-nonyl-2,3,4,5,8,9-hexahydrooxecin-10-one.
| Compound Name | (2R,4S,5S,8S)-4,5,8-trihydroxy-2-nonyl-2,3,4,5,8,9-hexahydrooxecin-10-one |
|---|---|
| PubChem CID | 177478080 |
| Molecular Formula | C18H32O5 |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | (2R,4S,5S,8S)-4,5,8-trihydroxy-2-nonyl-2,3,4,5,8,9-hexahydrooxecin-10-one |
| SMILES | CCCCCCCCC[C@@H]1C[C@H](O)[C@@H](O)C=C[C@@H](O)CC(=O)O1 |
| InChI | InChI=1S/C18H32O5/c1-2-3-4-5-6-7-8-9-15-13-17(21)16(20)11-10-14(19)12-18(22)23-15/h10-11,14-17,19-21H,2-9,12-13H2,1H3/t14-,15-,16+,17+/m1/s1 |
| InChIKey | VKFBQLMPTJTKBZ-NCOADZHNSA-N |
| XLogP | 2.47 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|