C9H16O2 — CID 101076795
(2S,3S)-2-pentyl-2,3-dihydrofuran-3-ol (PubChem CID 101076795) has the molecular formula C9H16O2 and a molecular weight of 156.22 g/mol. Its IUPAC name is (2S,3S)-2-pentyl-2,3-dihydrofuran-3-ol.
| Compound Name | (2S,3S)-2-pentyl-2,3-dihydrofuran-3-ol |
|---|---|
| PubChem CID | 101076795 |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.22 g/mol |
| Exact Mass | 156.12 |
| IUPAC Name | (2S,3S)-2-pentyl-2,3-dihydrofuran-3-ol |
| SMILES | CCCCC[C@@H]1OC=C[C@@H]1O |
| InChI | InChI=1S/C9H16O2/c1-2-3-4-5-9-8(10)6-7-11-9/h6-10H,2-5H2,1H3/t8-,9-/m0/s1 |
| InChIKey | UWCKJXDJKNNZIG-IUCAKERBSA-N |
| XLogP | 1.84 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.22 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|