C17H32O5 — CID 157213334
(4R,6R)-6-butyl-4-hydroxyoxan-2-one;(2R)-1-[(2R)-oxiran-2-yl]hexan-2-ol (PubChem CID 157213334) has the molecular formula C17H32O5 and a molecular weight of 316.44 g/mol. Its IUPAC name is (4R,6R)-6-butyl-4-hydroxyoxan-2-one;(2R)-1-[(2R)-oxiran-2-yl]hexan-2-ol.
| Compound Name | (4R,6R)-6-butyl-4-hydroxyoxan-2-one;(2R)-1-[(2R)-oxiran-2-yl]hexan-2-ol |
|---|---|
| PubChem CID | 157213334 |
| Molecular Formula | C17H32O5 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | (4R,6R)-6-butyl-4-hydroxyoxan-2-one;(2R)-1-[(2R)-oxiran-2-yl]hexan-2-ol |
| SMILES | CCCC[C@@H](O)C[C@@H]1CO1.CCCC[C@@H]1C[C@@H](O)CC(=O)O1 |
| InChI | InChI=1S/C9H16O3.C8H16O2/c1-2-3-4-8-5-7(10)6-9(11)12-8;1-2-3-4-7(9)5-8-6-10-8/h7-8,10H,2-6H2,1H3;7-9H,2-6H2,1H3/t2*7-,8-/m11/s1 |
| InChIKey | ASDFPSROLFGEGQ-GJMKNTOUSA-N |
| XLogP | 2.57 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|