C20H36O6 — CID 134842825
7-[(2R,4R,6R)-2,4,6-trihydroxytridecyl]-2,6-dioxabicyclo[3.3.1]nonan-3-one (PubChem CID 134842825) has the molecular formula C20H36O6 and a molecular weight of 372.50 g/mol. Its IUPAC name is 7-[(2R,4R,6R)-2,4,6-trihydroxytridecyl]-2,6-dioxabicyclo[3.3.1]nonan-3-one.
| Compound Name | 7-[(2R,4R,6R)-2,4,6-trihydroxytridecyl]-2,6-dioxabicyclo[3.3.1]nonan-3-one |
|---|---|
| PubChem CID | 134842825 |
| Molecular Formula | C20H36O6 |
| Molecular Weight | 372.50 g/mol |
| Exact Mass | 372.25 |
| IUPAC Name | 7-[(2R,4R,6R)-2,4,6-trihydroxytridecyl]-2,6-dioxabicyclo[3.3.1]nonan-3-one |
| SMILES | CCCCCCC[C@@H](O)C[C@@H](O)C[C@@H](O)CC1CC2CC(CC(=O)O2)O1 |
| InChI | InChI=1S/C20H36O6/c1-2-3-4-5-6-7-14(21)8-15(22)9-16(23)10-17-11-18-12-19(25-17)13-20(24)26-18/h14-19,21-23H,2-13H2,1H3/t14-,15-,16-,17?,18?,19?/m1/s1 |
| InChIKey | JUGNVZAVZDAHMJ-TWKMLSECSA-N |
| XLogP | 2.46 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.50 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|