C19H34O3 — CID 162818844
2-(2-hydroxytridecyl)-6-methyl-2,3-dihydropyran-4-one (PubChem CID 162818844) has the molecular formula C19H34O3 and a molecular weight of 310.48 g/mol. Its IUPAC name is 2-(2-hydroxytridecyl)-6-methyl-2,3-dihydropyran-4-one.
| Compound Name | 2-(2-hydroxytridecyl)-6-methyl-2,3-dihydropyran-4-one |
|---|---|
| PubChem CID | 162818844 |
| Molecular Formula | C19H34O3 |
| Molecular Weight | 310.48 g/mol |
| Exact Mass | 310.25 |
| IUPAC Name | 2-(2-hydroxytridecyl)-6-methyl-2,3-dihydropyran-4-one |
| SMILES | CCCCCCCCCCCC(O)CC1CC(=O)C=C(C)O1 |
| InChI | InChI=1S/C19H34O3/c1-3-4-5-6-7-8-9-10-11-12-17(20)14-19-15-18(21)13-16(2)22-19/h13,17,19-20H,3-12,14-15H2,1-2H3 |
| InChIKey | UJMNOSJXLDJKDE-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.48 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|