C19H34O2 — CID 163108678
(2S)-6-methyl-2-tridecyl-2,3-dihydropyran-4-one (PubChem CID 163108678) has the molecular formula C19H34O2 and a molecular weight of 294.48 g/mol. Its IUPAC name is (2S)-6-methyl-2-tridecyl-2,3-dihydropyran-4-one.
| Compound Name | (2S)-6-methyl-2-tridecyl-2,3-dihydropyran-4-one |
|---|---|
| PubChem CID | 163108678 |
| Molecular Formula | C19H34O2 |
| Molecular Weight | 294.48 g/mol |
| Exact Mass | 294.26 |
| IUPAC Name | (2S)-6-methyl-2-tridecyl-2,3-dihydropyran-4-one |
| SMILES | CCCCCCCCCCCCC[C@H]1CC(=O)C=C(C)O1 |
| InChI | InChI=1S/C19H34O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-19-16-18(20)15-17(2)21-19/h15,19H,3-14,16H2,1-2H3/t19-/m0/s1 |
| InChIKey | FONOWZGOSWFRBC-IBGZPJMESA-N |
| XLogP | 5.95 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.48 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|