C15H27NO — CID 134861677
(2S)-6-methyl-2-nonyl-2,3-dihydro-1H-pyridin-4-one (PubChem CID 134861677) has the molecular formula C15H27NO and a molecular weight of 237.39 g/mol. Its IUPAC name is (2S)-6-methyl-2-nonyl-2,3-dihydro-1H-pyridin-4-one.
| Compound Name | (2S)-6-methyl-2-nonyl-2,3-dihydro-1H-pyridin-4-one |
|---|---|
| PubChem CID | 134861677 |
| Molecular Formula | C15H27NO |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.21 |
| IUPAC Name | (2S)-6-methyl-2-nonyl-2,3-dihydro-1H-pyridin-4-one |
| SMILES | CCCCCCCCC[C@H]1CC(=O)C=C(C)N1 |
| InChI | InChI=1S/C15H27NO/c1-3-4-5-6-7-8-9-10-14-12-15(17)11-13(2)16-14/h11,14,16H,3-10,12H2,1-2H3/t14-/m0/s1 |
| InChIKey | KXVGCBZKFBDZAY-AWEZNQCLSA-N |
| XLogP | 3.96 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|