C26H50N4O3 — CID 161048784
12-hexyl-4,8-bis[4-(methylamino)butyl]-1,5-diazacyclododecane-2,6,10-trione (PubChem CID 161048784) has the molecular formula C26H50N4O3 and a molecular weight of 466.71 g/mol. Its IUPAC name is 12-hexyl-4,8-bis[4-(methylamino)butyl]-1,5-diazacyclododecane-2,6,10-trione.
| Compound Name | 12-hexyl-4,8-bis[4-(methylamino)butyl]-1,5-diazacyclododecane-2,6,10-trione |
|---|---|
| PubChem CID | 161048784 |
| Molecular Formula | C26H50N4O3 |
| Molecular Weight | 466.71 g/mol |
| Exact Mass | 466.39 |
| IUPAC Name | 12-hexyl-4,8-bis[4-(methylamino)butyl]-1,5-diazacyclododecane-2,6,10-trione |
| SMILES | CCCCCCC1CC(=O)CC(CCCCNC)CC(=O)NC(CCCCNC)CC(=O)N1 |
| InChI | InChI=1S/C26H50N4O3/c1-4-5-6-7-13-22-19-24(31)17-21(12-8-10-15-27-2)18-25(32)30-23(20-26(33)29-22)14-9-11-16-28-3/h21-23,27-28H,4-20H2,1-3H3,(H,29,33)(H,30,32) |
| InChIKey | UBVVIPSGWBHZQV-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.71 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|