C13H25NO — CID 24773544
(2R,6S)-2,6-dibutylpiperidin-4-one (PubChem CID 24773544) has the molecular formula C13H25NO and a molecular weight of 211.35 g/mol. Its IUPAC name is (2R,6S)-2,6-dibutylpiperidin-4-one.
| Compound Name | (2R,6S)-2,6-dibutylpiperidin-4-one |
|---|---|
| PubChem CID | 24773544 |
| Molecular Formula | C13H25NO |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.19 |
| IUPAC Name | (2R,6S)-2,6-dibutylpiperidin-4-one |
| SMILES | CCCC[C@@H]1CC(=O)C[C@H](CCCC)N1 |
| InChI | InChI=1S/C13H25NO/c1-3-5-7-11-9-13(15)10-12(14-11)8-6-4-2/h11-12,14H,3-10H2,1-2H3/t11-,12+ |
| InChIKey | MBPBECPFCIVADS-TXEJJXNPSA-N |
| XLogP | 3.06 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |