C9H18N2OS — CID 74561454
6-butyl-2-methylsulfanyl-1,3-diazinan-4-one (PubChem CID 74561454) has the molecular formula C9H18N2OS and a molecular weight of 202.32 g/mol. Its IUPAC name is 6-butyl-2-methylsulfanyl-1,3-diazinan-4-one.
| Compound Name | 6-butyl-2-methylsulfanyl-1,3-diazinan-4-one |
|---|---|
| PubChem CID | 74561454 |
| Molecular Formula | C9H18N2OS |
| Molecular Weight | 202.32 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | 6-butyl-2-methylsulfanyl-1,3-diazinan-4-one |
| SMILES | CCCCC1CC(=O)NC(SC)N1 |
| InChI | InChI=1S/C9H18N2OS/c1-3-4-5-7-6-8(12)11-9(10-7)13-2/h7,9-10H,3-6H2,1-2H3,(H,11,12) |
| InChIKey | KUAWSWBLBNXLPS-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.32 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |