C27H44O6 — CID 54153804
2-[(12S,14R)-12-hydroxy-14-(2-hydroxyundecyl)-10-methyl-2-oxo-1-oxacyclotetradeca-3,6,9-trien-4-yl]acetic acid (PubChem CID 54153804) has the molecular formula C27H44O6 and a molecular weight of 464.64 g/mol. Its IUPAC name is 2-[(12S,14R)-12-hydroxy-14-(2-hydroxyundecyl)-10-methyl-2-oxo-1-oxacyclotetradeca-3,6,9-trien-4-yl]acetic acid.
| Compound Name | 2-[(12S,14R)-12-hydroxy-14-(2-hydroxyundecyl)-10-methyl-2-oxo-1-oxacyclotetradeca-3,6,9-trien-4-yl]acetic acid |
|---|---|
| PubChem CID | 54153804 |
| Molecular Formula | C27H44O6 |
| Molecular Weight | 464.64 g/mol |
| Exact Mass | 464.31 |
| IUPAC Name | 2-[(12S,14R)-12-hydroxy-14-(2-hydroxyundecyl)-10-methyl-2-oxo-1-oxacyclotetradeca-3,6,9-trien-4-yl]acetic acid |
| SMILES | CCCCCCCCCC(O)C[C@@H]1C[C@@H](O)CC(C)=CCC=CCC(CC(=O)O)=CC(=O)O1 |
| InChI | InChI=1S/C27H44O6/c1-3-4-5-6-7-8-12-15-23(28)19-25-20-24(29)16-21(2)13-10-9-11-14-22(17-26(30)31)18-27(32)33-25/h9,11,13,18,23-25,28-29H,3-8,10,12,14-17,19-20H2,1-2H3,(H,30,31)/t23?,24-,25+/m0/s1 |
| InChIKey | OJPUZRWFAWDJHP-NCPLZGKYSA-N |
| XLogP | 5.63 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.64 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|