C30H38O6 — CID 162983600
2-[(1R,13S,15S)-15-hydroxy-11-methyl-15-(3-methyl-5-phenylpent-3-enyl)-3-oxo-2,14-dioxabicyclo[11.3.1]heptadeca-4,7,10-trien-5-yl]acetic acid (PubChem CID 162983600) has the molecular formula C30H38O6 and a molecular weight of 494.63 g/mol. Its IUPAC name is 2-[(1R,13S,15S)-15-hydroxy-11-methyl-15-(3-methyl-5-phenylpent-3-enyl)-3-oxo-2,14-dioxabicyclo[11.3.1]heptadeca-4,7,10-trien-5-yl]acetic acid.
| Compound Name | 2-[(1R,13S,15S)-15-hydroxy-11-methyl-15-(3-methyl-5-phenylpent-3-enyl)-3-oxo-2,14-dioxabicyclo[11.3.1]heptadeca-4,7,10-trien-5-yl]acetic acid |
|---|---|
| PubChem CID | 162983600 |
| Molecular Formula | C30H38O6 |
| Molecular Weight | 494.63 g/mol |
| Exact Mass | 494.27 |
| IUPAC Name | 2-[(1R,13S,15S)-15-hydroxy-11-methyl-15-(3-methyl-5-phenylpent-3-enyl)-3-oxo-2,14-dioxabicyclo[11.3.1]heptadeca-4,7,10-trien-5-yl]acetic acid |
| SMILES | CC(=CCc1ccccc1)CC[C@@]1(O)C[C@H]2C[C@H](CC(C)=CCC=CCC(CC(=O)O)=CC(=O)O2)O1 |
| InChI | InChI=1S/C30H38O6/c1-22(13-14-24-10-6-4-7-11-24)15-16-30(34)21-27-20-26(36-30)17-23(2)9-5-3-8-12-25(18-28(31)32)19-29(33)35-27/h3-4,6-11,13,19,26-27,34H,5,12,14-18,20-21H2,1-2H3,(H,31,32)/t26-,27+,30-/m0/s1 |
| InChIKey | ROPGADFKOUALIE-DURBRWELSA-N |
| XLogP | 5.82 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.63 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|