C39H60O5Si — CID 66575281
[(2S,4R,6R)-2-methoxy-6-[(2E)-2-methylhexa-2,5-dienyl]-2-[(E)-3-methyl-5-phenylpent-3-enyl]oxan-4-yl] (2E)-3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]hexa-2,5-dienoate (PubChem CID 66575281) has the molecular formula C39H60O5Si and a molecular weight of 636.99 g/mol. Its IUPAC name is [(2S,4R,6R)-2-methoxy-6-[(2E)-2-methylhexa-2,5-dienyl]-2-[(E)-3-methyl-5-phenylpent-3-enyl]oxan-4-yl] (2E)-3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]hexa-2,5-dienoate.
| Compound Name | [(2S,4R,6R)-2-methoxy-6-[(2E)-2-methylhexa-2,5-dienyl]-2-[(E)-3-methyl-5-phenylpent-3-enyl]oxan-4-yl] (2E)-3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]hexa-2,5-dienoate |
|---|---|
| PubChem CID | 66575281 |
| Molecular Formula | C39H60O5Si |
| Molecular Weight | 636.99 g/mol |
| Exact Mass | 636.42 |
| IUPAC Name | [(2S,4R,6R)-2-methoxy-6-[(2E)-2-methylhexa-2,5-dienyl]-2-[(E)-3-methyl-5-phenylpent-3-enyl]oxan-4-yl] (2E)-3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]hexa-2,5-dienoate |
| SMILES | C=CC/C=C(\C)C[C@@H]1C[C@@H](OC(=O)/C=C(\CC=C)CCO[Si](C)(C)C(C)(C)C)C[C@@](CC/C(C)=C/Cc2ccccc2)(OC)O1 |
| InChI | InChI=1S/C39H60O5Si/c1-11-13-18-32(4)27-35-29-36(43-37(40)28-34(17-12-2)24-26-42-45(9,10)38(5,6)7)30-39(41-8,44-35)25-23-31(3)21-22-33-19-15-14-16-20-33/h11-12,14-16,18-21,28,35-36H,1-2,13,17,22-27,29-30H2,3-10H3/b31-21+,32-18+,34-28+/t35-,36-,39+/m1/s1 |
| InChIKey | SBQAEGNHBYSBLM-NVUWALPBSA-N |
| XLogP | 10.22 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.99 |
| LogP ≤ 5 | 10.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|