C23H37NO3Si — CID 171941653
1-(9-benzyl-3-oxa-9-azabicyclo[3.3.1]nonan-7-yl)-3-[tert-butyl(dimethyl)silyl]oxypropan-1-one (PubChem CID 171941653) has the molecular formula C23H37NO3Si and a molecular weight of 403.64 g/mol. Its IUPAC name is 1-(9-benzyl-3-oxa-9-azabicyclo[3.3.1]nonan-7-yl)-3-[tert-butyl(dimethyl)silyl]oxypropan-1-one.
| Compound Name | 1-(9-benzyl-3-oxa-9-azabicyclo[3.3.1]nonan-7-yl)-3-[tert-butyl(dimethyl)silyl]oxypropan-1-one |
|---|---|
| PubChem CID | 171941653 |
| Molecular Formula | C23H37NO3Si |
| Molecular Weight | 403.64 g/mol |
| Exact Mass | 403.25 |
| IUPAC Name | 1-(9-benzyl-3-oxa-9-azabicyclo[3.3.1]nonan-7-yl)-3-[tert-butyl(dimethyl)silyl]oxypropan-1-one |
| SMILES | CC(C)(C)[Si](C)(C)OCCC(=O)C1CC2COCC(C1)N2Cc1ccccc1 |
| InChI | InChI=1S/C23H37NO3Si/c1-23(2,3)28(4,5)27-12-11-22(25)19-13-20-16-26-17-21(14-19)24(20)15-18-9-7-6-8-10-18/h6-10,19-21H,11-17H2,1-5H3 |
| InChIKey | SAZYXXZWNKJXHF-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.64 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|