C24H39NO3Si — CID 171948430
1-(9-benzyl-3-oxa-9-azabicyclo[3.3.1]nonan-7-yl)-4-[tert-butyl(dimethyl)silyl]oxybutan-1-one (PubChem CID 171948430) has the molecular formula C24H39NO3Si and a molecular weight of 417.67 g/mol. Its IUPAC name is 1-(9-benzyl-3-oxa-9-azabicyclo[3.3.1]nonan-7-yl)-4-[tert-butyl(dimethyl)silyl]oxybutan-1-one.
| Compound Name | 1-(9-benzyl-3-oxa-9-azabicyclo[3.3.1]nonan-7-yl)-4-[tert-butyl(dimethyl)silyl]oxybutan-1-one |
|---|---|
| PubChem CID | 171948430 |
| Molecular Formula | C24H39NO3Si |
| Molecular Weight | 417.67 g/mol |
| Exact Mass | 417.27 |
| IUPAC Name | 1-(9-benzyl-3-oxa-9-azabicyclo[3.3.1]nonan-7-yl)-4-[tert-butyl(dimethyl)silyl]oxybutan-1-one |
| SMILES | CC(C)(C)[Si](C)(C)OCCCC(=O)C1CC2COCC(C1)N2Cc1ccccc1 |
| InChI | InChI=1S/C24H39NO3Si/c1-24(2,3)29(4,5)28-13-9-12-23(26)20-14-21-17-27-18-22(15-20)25(21)16-19-10-7-6-8-11-19/h6-8,10-11,20-22H,9,12-18H2,1-5H3 |
| InChIKey | ZXQNYJHNKXINLD-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.67 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|