C21H31NO4 — CID 171945307
1-(9-benzyl-3-oxa-9-azabicyclo[3.3.1]nonan-7-yl)-3,3-diethoxypropan-1-one (PubChem CID 171945307) has the molecular formula C21H31NO4 and a molecular weight of 361.48 g/mol. Its IUPAC name is 1-(9-benzyl-3-oxa-9-azabicyclo[3.3.1]nonan-7-yl)-3,3-diethoxypropan-1-one.
| Compound Name | 1-(9-benzyl-3-oxa-9-azabicyclo[3.3.1]nonan-7-yl)-3,3-diethoxypropan-1-one |
|---|---|
| PubChem CID | 171945307 |
| Molecular Formula | C21H31NO4 |
| Molecular Weight | 361.48 g/mol |
| Exact Mass | 361.23 |
| IUPAC Name | 1-(9-benzyl-3-oxa-9-azabicyclo[3.3.1]nonan-7-yl)-3,3-diethoxypropan-1-one |
| SMILES | CCOC(CC(=O)C1CC2COCC(C1)N2Cc1ccccc1)OCC |
| InChI | InChI=1S/C21H31NO4/c1-3-25-21(26-4-2)12-20(23)17-10-18-14-24-15-19(11-17)22(18)13-16-8-6-5-7-9-16/h5-9,17-19,21H,3-4,10-15H2,1-2H3 |
| InChIKey | JNRIUUJHALVSTO-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.48 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|