C28H46O4Si — CID 11612588
[(E,3S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-8-methyl-1-oxo-10-phenyldec-8-en-3-yl] 2,2-dimethylpropanoate (PubChem CID 11612588) has the molecular formula C28H46O4Si and a molecular weight of 474.76 g/mol. Its IUPAC name is [(E,3S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-8-methyl-1-oxo-10-phenyldec-8-en-3-yl] 2,2-dimethylpropanoate.
| Compound Name | [(E,3S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-8-methyl-1-oxo-10-phenyldec-8-en-3-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 11612588 |
| Molecular Formula | C28H46O4Si |
| Molecular Weight | 474.76 g/mol |
| Exact Mass | 474.32 |
| IUPAC Name | [(E,3S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-8-methyl-1-oxo-10-phenyldec-8-en-3-yl] 2,2-dimethylpropanoate |
| SMILES | C/C(=C\Cc1ccccc1)CC[C@H](C[C@@H](CC=O)OC(=O)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H46O4Si/c1-22(15-17-23-13-11-10-12-14-23)16-18-25(32-33(8,9)28(5,6)7)21-24(19-20-29)31-26(30)27(2,3)4/h10-15,20,24-25H,16-19,21H2,1-9H3/b22-15+/t24-,25-/m1/s1 |
| InChIKey | KSRMRPCYCCASAK-GOVQPZEESA-N |
| XLogP | 7.28 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.76 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|