C21H32O2SSi — CID 10090971
[(E)-8-(benzenesulfinyl)-6-methyloct-6-en-1-yn-3-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 10090971) has the molecular formula C21H32O2SSi and a molecular weight of 376.64 g/mol. Its IUPAC name is [(E)-8-(benzenesulfinyl)-6-methyloct-6-en-1-yn-3-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(E)-8-(benzenesulfinyl)-6-methyloct-6-en-1-yn-3-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 10090971 |
| Molecular Formula | C21H32O2SSi |
| Molecular Weight | 376.64 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | [(E)-8-(benzenesulfinyl)-6-methyloct-6-en-1-yn-3-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | C#CC(CC/C(C)=C/CS(=O)c1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H32O2SSi/c1-8-19(23-25(6,7)21(3,4)5)15-14-18(2)16-17-24(22)20-12-10-9-11-13-20/h1,9-13,16,19H,14-15,17H2,2-7H3/b18-16+ |
| InChIKey | MRDYVMZNMHBYMM-FBMGVBCBSA-N |
| XLogP | 5.54 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.64 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|