C13H18O2S — CID 101222898
(E)-5-(benzenesulfinyl)-2,3-dimethylpent-3-en-2-ol (PubChem CID 101222898) has the molecular formula C13H18O2S and a molecular weight of 238.35 g/mol. Its IUPAC name is (E)-5-(benzenesulfinyl)-2,3-dimethylpent-3-en-2-ol.
| Compound Name | (E)-5-(benzenesulfinyl)-2,3-dimethylpent-3-en-2-ol |
|---|---|
| PubChem CID | 101222898 |
| Molecular Formula | C13H18O2S |
| Molecular Weight | 238.35 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | (E)-5-(benzenesulfinyl)-2,3-dimethylpent-3-en-2-ol |
| SMILES | C/C(=C\CS(=O)c1ccccc1)C(C)(C)O |
| InChI | InChI=1S/C13H18O2S/c1-11(13(2,3)14)9-10-16(15)12-7-5-4-6-8-12/h4-9,14H,10H2,1-3H3/b11-9+ |
| InChIKey | JOZOOHANKKHIRC-PKNBQFBNSA-N |
| XLogP | 2.51 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.35 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|