C10H13NO2S — CID 25183887
2-(benzenesulfinyl)-N,N-dimethylacetamide (PubChem CID 25183887) has the molecular formula C10H13NO2S and a molecular weight of 212.28 g/mol. Its IUPAC name is 2-(benzenesulfinyl)-N,N-dimethylacetamide.
| Compound Name | 2-(benzenesulfinyl)-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 25183887 |
| Molecular Formula | C10H13NO2S |
| Molecular Weight | 212.28 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | 2-(benzenesulfinyl)-N,N-dimethylacetamide |
| SMILES | CN(C)[13C](=O)CS(=O)c1ccccc1 |
| InChI | InChI=1S/C10H13NO2S/c1-11(2)10(12)8-14(13)9-6-4-3-5-7-9/h3-7H,8H2,1-2H3/i10+1 |
| InChIKey | WPVYRRXYIKBUSH-DETAZLGJSA-N |
| XLogP | 0.88 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.28 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |