About 2-(benzenesulfinyl)-N,N-dimethylacetamide
2-(benzenesulfinyl)-N,N-dimethylacetamide (PubChem CID 25183887) has the molecular formula C10H13NO2S
and a molecular weight of 212.28 g/mol. Its IUPAC name is 2-(benzenesulfinyl)-N,N-dimethylacetamide.
Molecular Properties
| Compound Name | 2-(benzenesulfinyl)-N,N-dimethylacetamide |
| PubChem CID | 25183887 |
| Molecular Formula | C10H13NO2S |
| Molecular Weight | 212.28 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | 2-(benzenesulfinyl)-N,N-dimethylacetamide |
| SMILES | CN(C)[13C](=O)CS(=O)c1ccccc1 |
| InChI | InChI=1S/C10H13NO2S/c1-11(2)10(12)8-14(13)9-6-4-3-5-7-9/h3-7H,8H2,1-2H3/i10+1 |
| InChIKey | WPVYRRXYIKBUSH-DETAZLGJSA-N |
| XLogP | 0.88 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.28 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(benzenesulfinyl)-N,N-dimethylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(benzenesulfinyl)-N,N-dimethylacetamide?
The IUPAC name of 2-(benzenesulfinyl)-N,N-dimethylacetamide (CID 25183887) is 2-(benzenesulfinyl)-N,N-dimethylacetamide.
What is the SMILES notation for 2-(benzenesulfinyl)-N,N-dimethylacetamide?
The canonical SMILES for 2-(benzenesulfinyl)-N,N-dimethylacetamide is CN(C)[13C](=O)CS(=O)c1ccccc1.
What is the InChIKey of 2-(benzenesulfinyl)-N,N-dimethylacetamide?
The InChIKey is WPVYRRXYIKBUSH-DETAZLGJSA-N. The full InChI is InChI=1S/C10H13NO2S/c1-11(2)10(12)8-14(13)9-6-4-3-5-7-9/h3-7H,8H2,1-2H3/i10+1.
What are the key properties of 2-(benzenesulfinyl)-N,N-dimethylacetamide?
2-(benzenesulfinyl)-N,N-dimethylacetamide has a molecular weight of 212.28 g/mol, XLogP of 0.88, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(benzenesulfinyl)-N,N-dimethylacetamide is sourced from PubChem (CID 25183887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).