About 2-(benzenesulfinyl)-N,N-dimethylethanamine;hydrochloride
2-(benzenesulfinyl)-N,N-dimethylethanamine;hydrochloride (PubChem CID 21391051) has the molecular formula C10H16ClNOS
and a molecular weight of 233.76 g/mol. Its IUPAC name is 2-(benzenesulfinyl)-N,N-dimethylethanamine;hydrochloride.
Molecular Properties
| Compound Name | 2-(benzenesulfinyl)-N,N-dimethylethanamine;hydrochloride |
| PubChem CID | 21391051 |
| Molecular Formula | C10H16ClNOS |
| Molecular Weight | 233.76 g/mol |
| Exact Mass | 233.06 |
| IUPAC Name | 2-(benzenesulfinyl)-N,N-dimethylethanamine;hydrochloride |
| SMILES | CN(C)CCS(=O)c1ccccc1.Cl |
| InChI | InChI=1S/C10H15NOS.ClH/c1-11(2)8-9-13(12)10-6-4-3-5-7-10;/h3-7H,8-9H2,1-2H3;1H |
| InChIKey | JOOYAAKNHRAKJO-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.76 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(benzenesulfinyl)-N,N-dimethylethanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(benzenesulfinyl)-N,N-dimethylethanamine;hydrochloride?
The IUPAC name of 2-(benzenesulfinyl)-N,N-dimethylethanamine;hydrochloride (CID 21391051) is 2-(benzenesulfinyl)-N,N-dimethylethanamine;hydrochloride.
What is the SMILES notation for 2-(benzenesulfinyl)-N,N-dimethylethanamine;hydrochloride?
The canonical SMILES for 2-(benzenesulfinyl)-N,N-dimethylethanamine;hydrochloride is CN(C)CCS(=O)c1ccccc1.Cl.
What is the InChIKey of 2-(benzenesulfinyl)-N,N-dimethylethanamine;hydrochloride?
The InChIKey is JOOYAAKNHRAKJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NOS.ClH/c1-11(2)8-9-13(12)10-6-4-3-5-7-10;/h3-7H,8-9H2,1-2H3;1H.
What are the key properties of 2-(benzenesulfinyl)-N,N-dimethylethanamine;hydrochloride?
2-(benzenesulfinyl)-N,N-dimethylethanamine;hydrochloride has a molecular weight of 233.76 g/mol, XLogP of 1.78, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(benzenesulfinyl)-N,N-dimethylethanamine;hydrochloride is sourced from PubChem (CID 21391051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).