About ethylsulfinylbenzene;palladium
ethylsulfinylbenzene;palladium (PubChem CID 174712422) has the molecular formula C8H10OPdS
and a molecular weight of 260.65 g/mol. Its IUPAC name is ethylsulfinylbenzene;palladium.
Molecular Properties
| Compound Name | ethylsulfinylbenzene;palladium |
| PubChem CID | 174712422 |
| Molecular Formula | C8H10OPdS |
| Molecular Weight | 260.65 g/mol |
| Exact Mass | 259.95 |
| IUPAC Name | ethylsulfinylbenzene;palladium |
| SMILES | CCS(=O)c1ccccc1.[Pd] |
| InChI | InChI=1S/C8H10OS.Pd/c1-2-10(9)8-6-4-3-5-7-8;/h3-7H,2H2,1H3; |
| InChIKey | XUGJETMMHOAIGP-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.65 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethylsulfinylbenzene;palladium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethylsulfinylbenzene;palladium?
The IUPAC name of ethylsulfinylbenzene;palladium (CID 174712422) is ethylsulfinylbenzene;palladium.
What is the SMILES notation for ethylsulfinylbenzene;palladium?
The canonical SMILES for ethylsulfinylbenzene;palladium is CCS(=O)c1ccccc1.[Pd].
What is the InChIKey of ethylsulfinylbenzene;palladium?
The InChIKey is XUGJETMMHOAIGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10OS.Pd/c1-2-10(9)8-6-4-3-5-7-8;/h3-7H,2H2,1H3;.
What are the key properties of ethylsulfinylbenzene;palladium?
ethylsulfinylbenzene;palladium has a molecular weight of 260.65 g/mol, XLogP of 1.81, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethylsulfinylbenzene;palladium is sourced from PubChem (CID 174712422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).