About benzenesulfinylmethyl propanoate
benzenesulfinylmethyl propanoate (PubChem CID 174216133) has the molecular formula C10H12O3S
and a molecular weight of 212.27 g/mol. Its IUPAC name is benzenesulfinylmethyl propanoate.
Molecular Properties
| Compound Name | benzenesulfinylmethyl propanoate |
| PubChem CID | 174216133 |
| Molecular Formula | C10H12O3S |
| Molecular Weight | 212.27 g/mol |
| Exact Mass | 212.05 |
| IUPAC Name | benzenesulfinylmethyl propanoate |
| SMILES | CCC(=O)OCS(=O)c1ccccc1 |
| InChI | InChI=1S/C10H12O3S/c1-2-10(11)13-8-14(12)9-6-4-3-5-7-9/h3-7H,2,8H2,1H3 |
| InChIKey | YGHFKEZJMOFARE-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.27 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze benzenesulfinylmethyl propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzenesulfinylmethyl propanoate?
The IUPAC name of benzenesulfinylmethyl propanoate (CID 174216133) is benzenesulfinylmethyl propanoate.
What is the SMILES notation for benzenesulfinylmethyl propanoate?
The canonical SMILES for benzenesulfinylmethyl propanoate is CCC(=O)OCS(=O)c1ccccc1.
What is the InChIKey of benzenesulfinylmethyl propanoate?
The InChIKey is YGHFKEZJMOFARE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O3S/c1-2-10(11)13-8-14(12)9-6-4-3-5-7-9/h3-7H,2,8H2,1H3.
What are the key properties of benzenesulfinylmethyl propanoate?
benzenesulfinylmethyl propanoate has a molecular weight of 212.27 g/mol, XLogP of 1.70, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzenesulfinylmethyl propanoate is sourced from PubChem (CID 174216133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).