About 2-(dimethylamino)-2-oxoethanesulfinic acid;yttrium
2-(dimethylamino)-2-oxoethanesulfinic acid;yttrium (PubChem CID 21337322) has the molecular formula C4H9NO3SY
and a molecular weight of 240.09 g/mol. Its IUPAC name is 2-(dimethylamino)-2-oxoethanesulfinic acid;yttrium.
Molecular Properties
| Compound Name | 2-(dimethylamino)-2-oxoethanesulfinic acid;yttrium |
| PubChem CID | 21337322 |
| Molecular Formula | C4H9NO3SY |
| Molecular Weight | 240.09 g/mol |
| Exact Mass | 239.94 |
| IUPAC Name | 2-(dimethylamino)-2-oxoethanesulfinic acid;yttrium |
| SMILES | CN(C)C(=O)CS(=O)O.[Y] |
| InChI | InChI=1S/C4H9NO3S.Y/c1-5(2)4(6)3-9(7)8;/h3H2,1-2H3,(H,7,8); |
| InChIKey | MKPYYYPNEWIQIY-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.09 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 2-(dimethylamino)-2-oxoethanesulfinic acid;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylamino)-2-oxoethanesulfinic acid;yttrium?
The IUPAC name of 2-(dimethylamino)-2-oxoethanesulfinic acid;yttrium (CID 21337322) is 2-(dimethylamino)-2-oxoethanesulfinic acid;yttrium.
What is the SMILES notation for 2-(dimethylamino)-2-oxoethanesulfinic acid;yttrium?
The canonical SMILES for 2-(dimethylamino)-2-oxoethanesulfinic acid;yttrium is CN(C)C(=O)CS(=O)O.[Y].
What is the InChIKey of 2-(dimethylamino)-2-oxoethanesulfinic acid;yttrium?
The InChIKey is MKPYYYPNEWIQIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NO3S.Y/c1-5(2)4(6)3-9(7)8;/h3H2,1-2H3,(H,7,8);.
What are the key properties of 2-(dimethylamino)-2-oxoethanesulfinic acid;yttrium?
2-(dimethylamino)-2-oxoethanesulfinic acid;yttrium has a molecular weight of 240.09 g/mol, XLogP of -0.71, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)-2-oxoethanesulfinic acid;yttrium is sourced from PubChem (CID 21337322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).