C10H13ClN2O2S — CID 81185117
2-(2-amino-6-chlorophenyl)sulfinyl-N,N-dimethylacetamide (PubChem CID 81185117) has the molecular formula C10H13ClN2O2S and a molecular weight of 260.75 g/mol. Its IUPAC name is 2-(2-amino-6-chlorophenyl)sulfinyl-N,N-dimethylacetamide.
| Compound Name | 2-(2-amino-6-chlorophenyl)sulfinyl-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 81185117 |
| Molecular Formula | C10H13ClN2O2S |
| Molecular Weight | 260.75 g/mol |
| Exact Mass | 260.04 |
| IUPAC Name | 2-(2-amino-6-chlorophenyl)sulfinyl-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)CS(=O)c1c(N)cccc1Cl |
| InChI | InChI=1S/C10H13ClN2O2S/c1-13(2)9(14)6-16(15)10-7(11)4-3-5-8(10)12/h3-5H,6,12H2,1-2H3 |
| InChIKey | WBKKGFKOEYQMAO-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.75 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|