C12H17ClN2O3S — CID 81185351
2-(2-amino-6-chlorophenyl)sulfinyl-N-(3-methoxypropyl)acetamide (PubChem CID 81185351) has the molecular formula C12H17ClN2O3S and a molecular weight of 304.80 g/mol. Its IUPAC name is 2-(2-amino-6-chlorophenyl)sulfinyl-N-(3-methoxypropyl)acetamide.
| Compound Name | 2-(2-amino-6-chlorophenyl)sulfinyl-N-(3-methoxypropyl)acetamide |
|---|---|
| PubChem CID | 81185351 |
| Molecular Formula | C12H17ClN2O3S |
| Molecular Weight | 304.80 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | 2-(2-amino-6-chlorophenyl)sulfinyl-N-(3-methoxypropyl)acetamide |
| SMILES | COCCCNC(=O)CS(=O)c1c(N)cccc1Cl |
| InChI | InChI=1S/C12H17ClN2O3S/c1-18-7-3-6-15-11(16)8-19(17)12-9(13)4-2-5-10(12)14/h2,4-5H,3,6-8,14H2,1H3,(H,15,16) |
| InChIKey | ZCXJFDFPOIKFQN-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.80 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|