2,3-dioxobutane-1-sulfinic acid

C4H6O4S — CID 154406405

IUPAC2,3-dioxobutane-1-sulfinic acid
SMILESCC(=O)C(=O)CS(=O)O
InChIInChI=1S/C4H6O4S/c1-3(5)4(6)2-9(7)8/h2H2,1H3,(H,7,8)
InChIKeyWISIQMCNRWJSHK-UHFFFAOYSA-N
MW150.15 g/mol
LogP-0.63
Rot. Bonds3

About 2,3-dioxobutane-1-sulfinic acid

2,3-dioxobutane-1-sulfinic acid (PubChem CID 154406405) has the molecular formula C4H6O4S and a molecular weight of 150.15 g/mol. Its IUPAC name is 2,3-dioxobutane-1-sulfinic acid.

Molecular Properties

Compound Name2,3-dioxobutane-1-sulfinic acid
PubChem CID154406405
Molecular FormulaC4H6O4S
Molecular Weight150.15 g/mol
Exact Mass150.00
IUPAC Name2,3-dioxobutane-1-sulfinic acid
SMILESCC(=O)C(=O)CS(=O)O
InChIInChI=1S/C4H6O4S/c1-3(5)4(6)2-9(7)8/h2H2,1H3,(H,7,8)
InChIKeyWISIQMCNRWJSHK-UHFFFAOYSA-N
XLogP-0.63
TPSA71.44 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms9
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500150.15
LogP ≤ 5-0.63
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}

Analyze 2,3-dioxobutane-1-sulfinic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,3-dioxobutane-1-sulfinic acid?
The IUPAC name of 2,3-dioxobutane-1-sulfinic acid (CID 154406405) is 2,3-dioxobutane-1-sulfinic acid.
What is the SMILES notation for 2,3-dioxobutane-1-sulfinic acid?
The canonical SMILES for 2,3-dioxobutane-1-sulfinic acid is CC(=O)C(=O)CS(=O)O.
What is the InChIKey of 2,3-dioxobutane-1-sulfinic acid?
The InChIKey is WISIQMCNRWJSHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O4S/c1-3(5)4(6)2-9(7)8/h2H2,1H3,(H,7,8).
What are the key properties of 2,3-dioxobutane-1-sulfinic acid?
2,3-dioxobutane-1-sulfinic acid has a molecular weight of 150.15 g/mol, XLogP of -0.63, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dioxobutane-1-sulfinic acid is sourced from PubChem (CID 154406405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).