About sodium;propan-2-one;sulfite
sodium;propan-2-one;sulfite (PubChem CID 22596868) has the molecular formula C3H6NaO4S-
and a molecular weight of 161.13 g/mol. Its IUPAC name is sodium;propan-2-one;sulfite.
Molecular Properties
| Compound Name | sodium;propan-2-one;sulfite |
| PubChem CID | 22596868 |
| Molecular Formula | C3H6NaO4S- |
| Molecular Weight | 161.13 g/mol |
| Exact Mass | 160.99 |
| IUPAC Name | sodium;propan-2-one;sulfite |
| SMILES | CC(C)=O.O=S([O-])[O-].[Na+] |
| InChI | InChI=1S/C3H6O.Na.H2O3S/c1-3(2)4;;1-4(2)3/h1-2H3;;(H2,1,2,3)/q;+1;/p-2 |
| InChIKey | AIWXQURDQHMMDO-UHFFFAOYSA-L |
| XLogP | -3.40 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.13 |
| LogP ≤ 5 | -3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze sodium;propan-2-one;sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;propan-2-one;sulfite?
The IUPAC name of sodium;propan-2-one;sulfite (CID 22596868) is sodium;propan-2-one;sulfite.
What is the SMILES notation for sodium;propan-2-one;sulfite?
The canonical SMILES for sodium;propan-2-one;sulfite is CC(C)=O.O=S([O-])[O-].[Na+].
What is the InChIKey of sodium;propan-2-one;sulfite?
The InChIKey is AIWXQURDQHMMDO-UHFFFAOYSA-L. The full InChI is InChI=1S/C3H6O.Na.H2O3S/c1-3(2)4;;1-4(2)3/h1-2H3;;(H2,1,2,3)/q;+1;/p-2.
What are the key properties of sodium;propan-2-one;sulfite?
sodium;propan-2-one;sulfite has a molecular weight of 161.13 g/mol, XLogP of -3.40, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;propan-2-one;sulfite is sourced from PubChem (CID 22596868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).