About sodium 1-oxoethanesulfinate
sodium 1-oxoethanesulfinate (PubChem CID 23715671) has the molecular formula C2H3NaO3S
and a molecular weight of 130.10 g/mol. Its IUPAC name is sodium 1-oxoethanesulfinate.
Molecular Properties
| Compound Name | sodium 1-oxoethanesulfinate |
| PubChem CID | 23715671 |
| Molecular Formula | C2H3NaO3S |
| Molecular Weight | 130.10 g/mol |
| Exact Mass | 129.97 |
| IUPAC Name | sodium 1-oxoethanesulfinate |
| SMILES | CC(=O)S(=O)[O-].[Na+] |
| InChI | InChI=1S/C2H4O3S.Na/c1-2(3)6(4)5;/h1H3,(H,4,5);/q;+1/p-1 |
| InChIKey | ILQMJPJBSCKHKX-UHFFFAOYSA-M |
| XLogP | -3.58 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.10 |
| LogP ≤ 5 | -3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze sodium 1-oxoethanesulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 1-oxoethanesulfinate?
The IUPAC name of sodium 1-oxoethanesulfinate (CID 23715671) is sodium 1-oxoethanesulfinate.
What is the SMILES notation for sodium 1-oxoethanesulfinate?
The canonical SMILES for sodium 1-oxoethanesulfinate is CC(=O)S(=O)[O-].[Na+].
What is the InChIKey of sodium 1-oxoethanesulfinate?
The InChIKey is ILQMJPJBSCKHKX-UHFFFAOYSA-M. The full InChI is InChI=1S/C2H4O3S.Na/c1-2(3)6(4)5;/h1H3,(H,4,5);/q;+1/p-1.
What are the key properties of sodium 1-oxoethanesulfinate?
sodium 1-oxoethanesulfinate has a molecular weight of 130.10 g/mol, XLogP of -3.58, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 1-oxoethanesulfinate is sourced from PubChem (CID 23715671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).