About 1-oxoethanesulfinamide
1-oxoethanesulfinamide (PubChem CID 154078299) has the molecular formula C2H5NO2S
and a molecular weight of 107.13 g/mol. Its IUPAC name is 1-oxoethanesulfinamide.
Molecular Properties
| Compound Name | 1-oxoethanesulfinamide |
| PubChem CID | 154078299 |
| Molecular Formula | C2H5NO2S |
| Molecular Weight | 107.13 g/mol |
| Exact Mass | 107.00 |
| IUPAC Name | 1-oxoethanesulfinamide |
| SMILES | CC(=O)S(N)=O |
| InChI | InChI=1S/C2H5NO2S/c1-2(4)6(3)5/h3H2,1H3 |
| InChIKey | CTUAELXBTUFQQX-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 107.13 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 1-oxoethanesulfinamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-oxoethanesulfinamide?
The IUPAC name of 1-oxoethanesulfinamide (CID 154078299) is 1-oxoethanesulfinamide.
What is the SMILES notation for 1-oxoethanesulfinamide?
The canonical SMILES for 1-oxoethanesulfinamide is CC(=O)S(N)=O.
What is the InChIKey of 1-oxoethanesulfinamide?
The InChIKey is CTUAELXBTUFQQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H5NO2S/c1-2(4)6(3)5/h3H2,1H3.
What are the key properties of 1-oxoethanesulfinamide?
1-oxoethanesulfinamide has a molecular weight of 107.13 g/mol, XLogP of -0.84, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-oxoethanesulfinamide is sourced from PubChem (CID 154078299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).