About 1-aminobutane-2,3-dione;azane
1-aminobutane-2,3-dione;azane (PubChem CID 87428205) has the molecular formula C4H10N2O2
and a molecular weight of 118.14 g/mol. Its IUPAC name is 1-aminobutane-2,3-dione;azane.
Molecular Properties
| Compound Name | 1-aminobutane-2,3-dione;azane |
| PubChem CID | 87428205 |
| Molecular Formula | C4H10N2O2 |
| Molecular Weight | 118.14 g/mol |
| Exact Mass | 118.07 |
| IUPAC Name | 1-aminobutane-2,3-dione;azane |
| SMILES | CC(=O)C(=O)CN.N |
| InChI | InChI=1S/C4H7NO2.H3N/c1-3(6)4(7)2-5;/h2,5H2,1H3;1H3 |
| InChIKey | NHEJGKDPKMCYOR-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 95.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.14 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 1-aminobutane-2,3-dione;azane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-aminobutane-2,3-dione;azane?
The IUPAC name of 1-aminobutane-2,3-dione;azane (CID 87428205) is 1-aminobutane-2,3-dione;azane.
What is the SMILES notation for 1-aminobutane-2,3-dione;azane?
The canonical SMILES for 1-aminobutane-2,3-dione;azane is CC(=O)C(=O)CN.N.
What is the InChIKey of 1-aminobutane-2,3-dione;azane?
The InChIKey is NHEJGKDPKMCYOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7NO2.H3N/c1-3(6)4(7)2-5;/h2,5H2,1H3;1H3.
What are the key properties of 1-aminobutane-2,3-dione;azane?
1-aminobutane-2,3-dione;azane has a molecular weight of 118.14 g/mol, XLogP of -0.73, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-aminobutane-2,3-dione;azane is sourced from PubChem (CID 87428205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).