C23H38O4Si — CID 101138351
(3R,8R)-3-[tert-butyl(dimethyl)silyl]oxy-8-phenylmethoxydecanedial (PubChem CID 101138351) has the molecular formula C23H38O4Si and a molecular weight of 406.64 g/mol. Its IUPAC name is (3R,8R)-3-[tert-butyl(dimethyl)silyl]oxy-8-phenylmethoxydecanedial.
| Compound Name | (3R,8R)-3-[tert-butyl(dimethyl)silyl]oxy-8-phenylmethoxydecanedial |
|---|---|
| PubChem CID | 101138351 |
| Molecular Formula | C23H38O4Si |
| Molecular Weight | 406.64 g/mol |
| Exact Mass | 406.25 |
| IUPAC Name | (3R,8R)-3-[tert-butyl(dimethyl)silyl]oxy-8-phenylmethoxydecanedial |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H](CC=O)CCCC[C@H](CC=O)OCc1ccccc1 |
| InChI | InChI=1S/C23H38O4Si/c1-23(2,3)28(4,5)27-22(16-18-25)14-10-9-13-21(15-17-24)26-19-20-11-7-6-8-12-20/h6-8,11-12,17-18,21-22H,9-10,13-16,19H2,1-5H3/t21-,22-/m1/s1 |
| InChIKey | WQNQIJOTXBXSMJ-FGZHOGPDSA-N |
| XLogP | 5.70 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.64 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|