C24H52O3Si2 — CID 101384249
(3S,6R)-3,6-bis[[tert-butyl(dimethyl)silyl]oxy]-10-methylundecanal (PubChem CID 101384249) has the molecular formula C24H52O3Si2 and a molecular weight of 444.85 g/mol. Its IUPAC name is (3S,6R)-3,6-bis[[tert-butyl(dimethyl)silyl]oxy]-10-methylundecanal.
| Compound Name | (3S,6R)-3,6-bis[[tert-butyl(dimethyl)silyl]oxy]-10-methylundecanal |
|---|---|
| PubChem CID | 101384249 |
| Molecular Formula | C24H52O3Si2 |
| Molecular Weight | 444.85 g/mol |
| Exact Mass | 444.35 |
| IUPAC Name | (3S,6R)-3,6-bis[[tert-butyl(dimethyl)silyl]oxy]-10-methylundecanal |
| SMILES | CC(C)CCC[C@H](CC[C@@H](CC=O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H52O3Si2/c1-20(2)14-13-15-21(26-28(9,10)23(3,4)5)16-17-22(18-19-25)27-29(11,12)24(6,7)8/h19-22H,13-18H2,1-12H3/t21-,22+/m1/s1 |
| InChIKey | IPPWVGSOLRHUEC-YADHBBJMSA-N |
| XLogP | 7.96 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.85 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|